C25H34O6 — CID 156751550
8-(3,7-dimethylocta-2,6-dienyl)-7-hydroxy-2-methyl-4-oxo-5-pentyl-1,3-benzodioxine-2-carboxylic acid (PubChem CID 156751550) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 8-(3,7-dimethylocta-2,6-dienyl)-7-hydroxy-2-methyl-4-oxo-5-pentyl-1,3-benzodioxine-2-carboxylic acid.
| Compound Name | 8-(3,7-dimethylocta-2,6-dienyl)-7-hydroxy-2-methyl-4-oxo-5-pentyl-1,3-benzodioxine-2-carboxylic acid |
|---|---|
| PubChem CID | 156751550 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 8-(3,7-dimethylocta-2,6-dienyl)-7-hydroxy-2-methyl-4-oxo-5-pentyl-1,3-benzodioxine-2-carboxylic acid |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c2c1C(=O)OC(C)(C(=O)O)O2 |
| InChI | InChI=1S/C25H34O6/c1-6-7-8-12-18-15-20(26)19(14-13-17(4)11-9-10-16(2)3)22-21(18)23(27)31-25(5,30-22)24(28)29/h10,13,15,26H,6-9,11-12,14H2,1-5H3,(H,28,29) |
| InChIKey | OWMCWNHCKQNXGO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|