C27H32O4 — CID 156751551
8-(3,7-dimethylocta-2,6-dienyl)-7-hydroxy-2-phenyl-5-propyl-1,3-benzodioxin-4-one (PubChem CID 156751551) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 8-(3,7-dimethylocta-2,6-dienyl)-7-hydroxy-2-phenyl-5-propyl-1,3-benzodioxin-4-one.
| Compound Name | 8-(3,7-dimethylocta-2,6-dienyl)-7-hydroxy-2-phenyl-5-propyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 156751551 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 8-(3,7-dimethylocta-2,6-dienyl)-7-hydroxy-2-phenyl-5-propyl-1,3-benzodioxin-4-one |
| SMILES | CCCc1cc(O)c(CC=C(C)CCC=C(C)C)c2c1C(=O)OC(c1ccccc1)O2 |
| InChI | InChI=1S/C27H32O4/c1-5-10-21-17-23(28)22(16-15-19(4)12-9-11-18(2)3)25-24(21)26(29)31-27(30-25)20-13-7-6-8-14-20/h6-8,11,13-15,17,27-28H,5,9-10,12,16H2,1-4H3 |
| InChIKey | OCUQYDQOXRDOOS-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|