C25H28O2 — CID 87409349
8-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 87409349) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 8-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | 8-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 87409349 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 8-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cccc2c1OC(c1ccccc1)CC2=O |
| InChI | InChI=1S/C25H28O2/c1-18(2)9-7-10-19(3)15-16-21-13-8-14-22-23(26)17-24(27-25(21)22)20-11-5-4-6-12-20/h4-6,8-9,11-15,24H,7,10,16-17H2,1-3H3/b19-15+ |
| InChIKey | PZQIUZXFLFHCPP-XDJHFCHBSA-N |
| XLogP | 6.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|