C30H38O2 — CID 53361119
2,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-1,4-dione (PubChem CID 53361119) has the molecular formula C30H38O2 and a molecular weight of 430.63 g/mol. Its IUPAC name is 2,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-1,4-dione.
| Compound Name | 2,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 53361119 |
| Molecular Formula | C30H38O2 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 2,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-1,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC1=C(C/C=C(\C)CCC=C(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H38O2/c1-21(2)11-9-13-23(5)17-19-27-28(20-18-24(6)14-10-12-22(3)4)30(32)26-16-8-7-15-25(26)29(27)31/h7-8,11-12,15-18H,9-10,13-14,19-20H2,1-6H3/b23-17+,24-18+ |
| InChIKey | RFLKWKUSIMPBIK-GJHDBBOXSA-N |
| XLogP | 8.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|