C28H36O2 — CID 67706161
2,6,7-trimethyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalene-1,4-dione (PubChem CID 67706161) has the molecular formula C28H36O2 and a molecular weight of 404.59 g/mol. Its IUPAC name is 2,6,7-trimethyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalene-1,4-dione.
| Compound Name | 2,6,7-trimethyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 67706161 |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 2,6,7-trimethyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalene-1,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC1=C(C)C(=O)c2cc(C)c(C)cc2C1=O |
| InChI | InChI=1S/C28H36O2/c1-18(2)10-8-11-19(3)12-9-13-20(4)14-15-24-23(7)27(29)25-16-21(5)22(6)17-26(25)28(24)30/h10,12,14,16-17H,8-9,11,13,15H2,1-7H3/b19-12+,20-14+ |
| InChIKey | UHIVVFCEUPYRSW-LCAIAVFMSA-N |
| XLogP | 7.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|