C19H26O4 — CID 58435873
2-(3,7-dimethylocta-2,6-dienyl)-5,6-bis(hydroxymethyl)-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 58435873) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-5,6-bis(hydroxymethyl)-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-5,6-bis(hydroxymethyl)-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 58435873 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-5,6-bis(hydroxymethyl)-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=CCCC(C)=CCC1=C(C)C(=O)C(CO)=C(CO)C1=O |
| InChI | InChI=1S/C19H26O4/c1-12(2)6-5-7-13(3)8-9-15-14(4)18(22)16(10-20)17(11-21)19(15)23/h6,8,20-21H,5,7,9-11H2,1-4H3 |
| InChIKey | VLYDVOSLWQFDOB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|