C30H44O2 — CID 144515239
2,3,5-trimethyl-6-[2-[1-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]cyclopropyl]ethyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 144515239) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-[2-[1-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]cyclopropyl]ethyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trimethyl-6-[2-[1-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]cyclopropyl]ethyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 144515239 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | 2,3,5-trimethyl-6-[2-[1-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]cyclopropyl]ethyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(CCC2=C(C)C(=O)C(C)=C(C)C2=O)CC1 |
| InChI | InChI=1S/C30H44O2/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-17-30(19-20-30)18-16-27-26(7)28(31)24(5)25(6)29(27)32/h11,13,15H,8-10,12,14,16-20H2,1-7H3/b22-13+,23-15+ |
| InChIKey | ZSEOSERZABDKPM-JWIKZEKMSA-N |
| XLogP | 8.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|