C23H33FO3 — CID 160877266
2-[(3R,6E,10Z)-11-fluoro-3-hydroxy-3,7-dimethyldodeca-6,10-dienyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 160877266) has the molecular formula C23H33FO3 and a molecular weight of 376.51 g/mol. Its IUPAC name is 2-[(3R,6E,10Z)-11-fluoro-3-hydroxy-3,7-dimethyldodeca-6,10-dienyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(3R,6E,10Z)-11-fluoro-3-hydroxy-3,7-dimethyldodeca-6,10-dienyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 160877266 |
| Molecular Formula | C23H33FO3 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 2-[(3R,6E,10Z)-11-fluoro-3-hydroxy-3,7-dimethyldodeca-6,10-dienyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CC[C@](C)(O)CC/C=C(\C)CC/C=C(/C)F)=C(C)C1=O |
| InChI | InChI=1S/C23H33FO3/c1-15(9-7-11-16(2)24)10-8-13-23(6,27)14-12-20-19(5)21(25)17(3)18(4)22(20)26/h10-11,27H,7-9,12-14H2,1-6H3/b15-10+,16-11-/t23-/m1/s1 |
| InChIKey | QBNMRYKEEIJJHG-HULAVRKRSA-N |
| XLogP | 5.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|