C27H42O3 — CID 71117249
5-(3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl)-3-methylbenzene-1,2-diol (PubChem CID 71117249) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is 5-(3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl)-3-methylbenzene-1,2-diol.
| Compound Name | 5-(3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl)-3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 71117249 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 5-(3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl)-3-methylbenzene-1,2-diol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)(O)CCc1cc(C)c(O)c(O)c1 |
| InChI | InChI=1S/C27H42O3/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-16-27(6,30)17-15-24-18-23(5)26(29)25(28)19-24/h10,12,14,18-19,28-30H,7-9,11,13,15-17H2,1-6H3 |
| InChIKey | KZNFBYXJPCOVAR-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|