C27H40O2 — CID 162951969
1-(2,8-dimethyl-4H-chromen-6-yl)-3,8,12-trimethyltrideca-7,11-dien-3-ol (PubChem CID 162951969) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is 1-(2,8-dimethyl-4H-chromen-6-yl)-3,8,12-trimethyltrideca-7,11-dien-3-ol.
| Compound Name | 1-(2,8-dimethyl-4H-chromen-6-yl)-3,8,12-trimethyltrideca-7,11-dien-3-ol |
|---|---|
| PubChem CID | 162951969 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 1-(2,8-dimethyl-4H-chromen-6-yl)-3,8,12-trimethyltrideca-7,11-dien-3-ol |
| SMILES | CC(C)=CCCC(C)=CCCCC(C)(O)CCc1cc(C)c2c(c1)CC=C(C)O2 |
| InChI | InChI=1S/C27H40O2/c1-20(2)10-9-12-21(3)11-7-8-16-27(6,28)17-15-24-18-22(4)26-25(19-24)14-13-23(5)29-26/h10-11,13,18-19,28H,7-9,12,14-17H2,1-6H3 |
| InChIKey | FIFQIKZAAHTCIQ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|