C29H44O — CID 176937160
2,6,8-trimethyl-2-[(3E,8E)-4,9,13-trimethyltetradeca-3,8,12-trienyl]-3,4-dihydrochromene (PubChem CID 176937160) has the molecular formula C29H44O and a molecular weight of 408.67 g/mol. Its IUPAC name is 2,6,8-trimethyl-2-[(3E,8E)-4,9,13-trimethyltetradeca-3,8,12-trienyl]-3,4-dihydrochromene.
| Compound Name | 2,6,8-trimethyl-2-[(3E,8E)-4,9,13-trimethyltetradeca-3,8,12-trienyl]-3,4-dihydrochromene |
|---|---|
| PubChem CID | 176937160 |
| Molecular Formula | C29H44O |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | 2,6,8-trimethyl-2-[(3E,8E)-4,9,13-trimethyltetradeca-3,8,12-trienyl]-3,4-dihydrochromene |
| SMILES | CC(C)=CCC/C(C)=C/CCC/C(C)=C/CCC1(C)CCc2cc(C)cc(C)c2O1 |
| InChI | InChI=1S/C29H44O/c1-22(2)12-10-15-23(3)13-8-9-14-24(4)16-11-18-29(7)19-17-27-21-25(5)20-26(6)28(27)30-29/h12-13,16,20-21H,8-11,14-15,17-19H2,1-7H3/b23-13+,24-16+ |
| InChIKey | MIXJDQYPVDJCPC-OENTUMBLSA-N |
| XLogP | 8.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|