C28H42O — CID 144558587
(2R)-2,5,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene (PubChem CID 144558587) has the molecular formula C28H42O and a molecular weight of 394.64 g/mol. Its IUPAC name is (2R)-2,5,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene.
| Compound Name | (2R)-2,5,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene |
|---|---|
| PubChem CID | 144558587 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | (2R)-2,5,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c(C)ccc(C)c2O1 |
| InChI | InChI=1S/C28H42O/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-19-28(7)20-18-26-24(5)16-17-25(6)27(26)29-28/h11,13,15-17H,8-10,12,14,18-20H2,1-7H3/b22-13+,23-15+/t28-/m1/s1 |
| InChIKey | CHDFBFAZWICJAF-BLOHLNEFSA-N |
| XLogP | 8.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|