C28H42O3 — CID 163193306
(2S)-2,5,6-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene-7,8-diol (PubChem CID 163193306) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (2S)-2,5,6-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene-7,8-diol.
| Compound Name | (2S)-2,5,6-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene-7,8-diol |
|---|---|
| PubChem CID | 163193306 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (2S)-2,5,6-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene-7,8-diol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@@]1(C)CCc2c(C)c(C)c(O)c(O)c2O1 |
| InChI | InChI=1S/C28H42O3/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-17-28(7)18-16-24-22(5)23(6)25(29)26(30)27(24)31-28/h11,13,15,29-30H,8-10,12,14,16-18H2,1-7H3/b20-13+,21-15+/t28-/m0/s1 |
| InChIKey | QLPJBLZJTMXETL-HBNUPATHSA-N |
| XLogP | 8.00 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|