C29H43O2Si — CID 175265599
CID 175265599 (PubChem CID 175265599) has the molecular formula C29H43O2Si and a molecular weight of 451.75 g/mol.
| Compound Name | CID 175265599 |
|---|---|
| PubChem CID | 175265599 |
| Molecular Formula | C29H43O2Si |
| Molecular Weight | 451.75 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | — |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c(C)c(O[Si])c(C)c(C)c2O1 |
| InChI | InChI=1S/C29H43O2Si/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(31-32)23(5)24(6)28(26)30-29/h12,14,16H,9-11,13,15,17-19H2,1-8H3/b21-14+,22-16+/t29-/m1/s1 |
| InChIKey | HSPFTJMFWNRITH-XZXLULOTSA-N |
| XLogP | 8.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.75 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|