C23H32F2O — CID 159207138
(2R)-2-[(3E)-8,8-difluoro-4-methylocta-3,7-dienyl]-2,5,6,7,8-pentamethyl-3,4-dihydrochromene (PubChem CID 159207138) has the molecular formula C23H32F2O and a molecular weight of 362.50 g/mol. Its IUPAC name is (2R)-2-[(3E)-8,8-difluoro-4-methylocta-3,7-dienyl]-2,5,6,7,8-pentamethyl-3,4-dihydrochromene.
| Compound Name | (2R)-2-[(3E)-8,8-difluoro-4-methylocta-3,7-dienyl]-2,5,6,7,8-pentamethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 159207138 |
| Molecular Formula | C23H32F2O |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (2R)-2-[(3E)-8,8-difluoro-4-methylocta-3,7-dienyl]-2,5,6,7,8-pentamethyl-3,4-dihydrochromene |
| SMILES | C/C(=C\CC[C@]1(C)CCc2c(C)c(C)c(C)c(C)c2O1)CCC=C(F)F |
| InChI | InChI=1S/C23H32F2O/c1-15(9-7-11-21(24)25)10-8-13-23(6)14-12-20-18(4)16(2)17(3)19(5)22(20)26-23/h10-11H,7-9,12-14H2,1-6H3/b15-10+/t23-/m1/s1 |
| InChIKey | UURCDCOZZMNYIA-WIJYMUHASA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|