C31H48ClNO3 — CID 10164844
[2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] 2-aminoacetate;hydrochloride (PubChem CID 10164844) has the molecular formula C31H48ClNO3 and a molecular weight of 518.18 g/mol. Its IUPAC name is [2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] 2-aminoacetate;hydrochloride.
| Compound Name | [2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] 2-aminoacetate;hydrochloride |
|---|---|
| PubChem CID | 10164844 |
| Molecular Formula | C31H48ClNO3 |
| Molecular Weight | 518.18 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | [2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] 2-aminoacetate;hydrochloride |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)CCc2c(C)c(OC(=O)CN)c(C)c(C)c2O1.Cl |
| InChI | InChI=1S/C31H47NO3.ClH/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-18-31(8)19-17-27-26(7)29(34-28(33)20-32)24(5)25(6)30(27)35-31;/h12,14,16H,9-11,13,15,17-20,32H2,1-8H3;1H/b22-14+,23-16+; |
| InChIKey | DGIFKTDNJISUEV-TZMRSKHASA-N |
| XLogP | 8.18 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.18 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|