C37H60NO6P — CID 159478414
methyl-[6-[[(2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxycarbonylamino]hexoxy]phosphinic acid (PubChem CID 159478414) has the molecular formula C37H60NO6P and a molecular weight of 645.86 g/mol. Its IUPAC name is methyl-[6-[[(2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxycarbonylamino]hexoxy]phosphinic acid.
| Compound Name | methyl-[6-[[(2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxycarbonylamino]hexoxy]phosphinic acid |
|---|---|
| PubChem CID | 159478414 |
| Molecular Formula | C37H60NO6P |
| Molecular Weight | 645.86 g/mol |
| Exact Mass | 645.42 |
| IUPAC Name | methyl-[6-[[(2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxycarbonylamino]hexoxy]phosphinic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c(C)c(OC(=O)NCCCCCCOP(C)(=O)O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C37H60NO6P/c1-27(2)17-14-18-28(3)19-15-20-29(4)21-16-23-37(8)24-22-33-32(7)34(30(5)31(6)35(33)44-37)43-36(39)38-25-12-10-11-13-26-42-45(9,40)41/h17,19,21H,10-16,18,20,22-26H2,1-9H3,(H,38,39)(H,40,41)/b28-19+,29-21+/t37-/m1/s1 |
| InChIKey | BRRVBKFZGJSUBO-OMPTZAJASA-N |
| XLogP | 10.38 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.86 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|