C48H79O10P — CID 53234757
2-ethylbutyl 2-[[2-(2-ethylbutoxy)-2-oxoethoxy]-[3-[[(2S)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxy]propoxy]phosphoryl]oxyacetate (PubChem CID 53234757) has the molecular formula C48H79O10P and a molecular weight of 847.12 g/mol. Its IUPAC name is 2-ethylbutyl 2-[[2-(2-ethylbutoxy)-2-oxoethoxy]-[3-[[(2S)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxy]propoxy]phosphoryl]oxyacetate.
| Compound Name | 2-ethylbutyl 2-[[2-(2-ethylbutoxy)-2-oxoethoxy]-[3-[[(2S)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxy]propoxy]phosphoryl]oxyacetate |
|---|---|
| PubChem CID | 53234757 |
| Molecular Formula | C48H79O10P |
| Molecular Weight | 847.12 g/mol |
| Exact Mass | 846.54 |
| IUPAC Name | 2-ethylbutyl 2-[[2-(2-ethylbutoxy)-2-oxoethoxy]-[3-[[(2S)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxy]propoxy]phosphoryl]oxyacetate |
| SMILES | CCC(CC)COC(=O)COP(=O)(OCCCOc1c(C)c(C)c2c(c1C)CC[C@](C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)O2)OCC(=O)OCC(CC)CC |
| InChI | InChI=1S/C48H79O10P/c1-13-41(14-2)31-53-44(49)33-56-59(51,57-34-45(50)54-32-42(15-3)16-4)55-30-20-29-52-46-38(9)39(10)47-43(40(46)11)26-28-48(12,58-47)27-19-25-37(8)24-18-23-36(7)22-17-21-35(5)6/h21,23,25,41-42H,13-20,22,24,26-34H2,1-12H3/b36-23+,37-25+/t48-/m0/s1 |
| InChIKey | NAMAYMQDZYJINR-DZIFELQFSA-N |
| XLogP | 12.78 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.12 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|