C38H48O7 — CID 67350142
2-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromen-6-yl]oxycarbonyl]terephthalic acid (PubChem CID 67350142) has the molecular formula C38H48O7 and a molecular weight of 616.80 g/mol. Its IUPAC name is 2-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromen-6-yl]oxycarbonyl]terephthalic acid.
| Compound Name | 2-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromen-6-yl]oxycarbonyl]terephthalic acid |
|---|---|
| PubChem CID | 67350142 |
| Molecular Formula | C38H48O7 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | 2-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromen-6-yl]oxycarbonyl]terephthalic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC1(C)CCc2c(C)c(OC(=O)c3cc(C(=O)O)ccc3C(=O)O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C38H48O7/c1-23(2)12-9-13-24(3)14-10-15-25(4)16-11-20-38(8)21-19-30-28(7)33(26(5)27(6)34(30)45-38)44-37(43)32-22-29(35(39)40)17-18-31(32)36(41)42/h12,14,16-18,22H,9-11,13,15,19-21H2,1-8H3,(H,39,40)(H,41,42) |
| InChIKey | PMUIKVROWIISMT-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|