C29H41F3O4S — CID 42637946
[2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] trifluoromethanesulfonate (PubChem CID 42637946) has the molecular formula C29H41F3O4S and a molecular weight of 542.70 g/mol. Its IUPAC name is [2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] trifluoromethanesulfonate.
| Compound Name | [2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 42637946 |
| Molecular Formula | C29H41F3O4S |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | [2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] trifluoromethanesulfonate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)CCc2cc(OS(=O)(=O)C(F)(F)F)c(C)c(C)c2O1 |
| InChI | InChI=1S/C29H41F3O4S/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(23(5)24(6)27(25)35-28)36-37(33,34)29(30,31)32/h11,13,15,19H,8-10,12,14,16-18H2,1-7H3/b21-13+,22-15+ |
| InChIKey | KVMNPANYHMAUJK-NTZRDTQNSA-N |
| XLogP | 8.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|