C38H57NO3 — CID 163240127
ethane;[2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] pyridine-3-carboxylate (PubChem CID 163240127) has the molecular formula C38H57NO3 and a molecular weight of 575.88 g/mol. Its IUPAC name is ethane;[2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] pyridine-3-carboxylate.
| Compound Name | ethane;[2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 163240127 |
| Molecular Formula | C38H57NO3 |
| Molecular Weight | 575.88 g/mol |
| Exact Mass | 575.43 |
| IUPAC Name | ethane;[2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] pyridine-3-carboxylate |
| SMILES | CC.CC.CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)CCc2cc(OC(=O)c3cccnc3)c(C)c(C)c2O1 |
| InChI | InChI=1S/C34H45NO3.2C2H6/c1-24(2)12-8-13-25(3)14-9-15-26(4)16-10-19-34(7)20-18-29-22-31(27(5)28(6)32(29)38-34)37-33(36)30-17-11-21-35-23-30;2*1-2/h11-12,14,16-17,21-23H,8-10,13,15,18-20H2,1-7H3;2*1-2H3/b25-14+,26-16+;; |
| InChIKey | HUYYWGRLYWRMQL-SIXRDBFKSA-N |
| XLogP | 11.25 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.88 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|