C32H51BrO2Si — CID 10460768
[8-bromo-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10460768) has the molecular formula C32H51BrO2Si and a molecular weight of 575.75 g/mol. Its IUPAC name is [8-bromo-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [8-bromo-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10460768 |
| Molecular Formula | C32H51BrO2Si |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | [8-bromo-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)CCc2cc(O[Si](C)(C)C(C)(C)C)cc(Br)c2O1 |
| InChI | InChI=1S/C32H51BrO2Si/c1-24(2)14-11-15-25(3)16-12-17-26(4)18-13-20-32(8)21-19-27-22-28(23-29(33)30(27)34-32)35-36(9,10)31(5,6)7/h14,16,18,22-23H,11-13,15,17,19-21H2,1-10H3/b25-16+,26-18+ |
| InChIKey | HATVJXUMJDWSDE-BNBFUNNKSA-N |
| XLogP | 11.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|