C30H40O2 — CID 54322296
2-methyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrobenzo[h]chromen-6-ol (PubChem CID 54322296) has the molecular formula C30H40O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is 2-methyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrobenzo[h]chromen-6-ol.
| Compound Name | 2-methyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrobenzo[h]chromen-6-ol |
|---|---|
| PubChem CID | 54322296 |
| Molecular Formula | C30H40O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 2-methyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrobenzo[h]chromen-6-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC1(C)CCc2cc(O)c3ccccc3c2O1 |
| InChI | InChI=1S/C30H40O2/c1-22(2)11-8-12-23(3)13-9-14-24(4)15-10-19-30(5)20-18-25-21-28(31)26-16-6-7-17-27(26)29(25)32-30/h6-7,11,13,15-17,21,31H,8-10,12,14,18-20H2,1-5H3 |
| InChIKey | SSMGTBPZZYREEN-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|