C28H42O2 — CID 102242640
(2S)-2,7,8-trimethyl-2-[(3Z,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol (PubChem CID 102242640) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is (2S)-2,7,8-trimethyl-2-[(3Z,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol.
| Compound Name | (2S)-2,7,8-trimethyl-2-[(3Z,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 102242640 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | (2S)-2,7,8-trimethyl-2-[(3Z,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C\CC[C@@]1(C)CCc2cc(O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C28H42O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h11,13,15,19,29H,8-10,12,14,16-18H2,1-7H3/b21-13+,22-15-/t28-/m0/s1 |
| InChIKey | OTXNTMVVOOBZCV-GKHDBUHSSA-N |
| XLogP | 8.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|