C28H34O4 — CID 164625982
[(2R)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5,7-dihydroxy-2-methyl-3,4-dihydrochromen-8-yl]-phenylmethanone (PubChem CID 164625982) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is [(2R)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5,7-dihydroxy-2-methyl-3,4-dihydrochromen-8-yl]-phenylmethanone.
| Compound Name | [(2R)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5,7-dihydroxy-2-methyl-3,4-dihydrochromen-8-yl]-phenylmethanone |
|---|---|
| PubChem CID | 164625982 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | [(2R)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5,7-dihydroxy-2-methyl-3,4-dihydrochromen-8-yl]-phenylmethanone |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@]1(C)CCc2c(O)cc(O)c(C(=O)c3ccccc3)c2O1 |
| InChI | InChI=1S/C28H34O4/c1-19(2)10-8-11-20(3)12-9-16-28(4)17-15-22-23(29)18-24(30)25(27(22)32-28)26(31)21-13-6-5-7-14-21/h5-7,10,12-14,18,29-30H,8-9,11,15-17H2,1-4H3/b20-12+/t28-/m1/s1 |
| InChIKey | AXIBKHPBIOBPDM-HQHUSCBDSA-N |
| XLogP | 6.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|