C23H26O4 — CID 162875840
[(2S)-5,7-dihydroxy-2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromen-6-yl]-phenylmethanone (PubChem CID 162875840) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is [(2S)-5,7-dihydroxy-2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromen-6-yl]-phenylmethanone.
| Compound Name | [(2S)-5,7-dihydroxy-2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromen-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 162875840 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [(2S)-5,7-dihydroxy-2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromen-6-yl]-phenylmethanone |
| SMILES | CC(C)=CCC[C@@]1(C)CCc2c(cc(O)c(C(=O)c3ccccc3)c2O)O1 |
| InChI | InChI=1S/C23H26O4/c1-15(2)8-7-12-23(3)13-11-17-19(27-23)14-18(24)20(22(17)26)21(25)16-9-5-4-6-10-16/h4-6,8-10,14,24,26H,7,11-13H2,1-3H3/t23-/m0/s1 |
| InChIKey | HNILUNOZWDAQPO-QHCPKHFHSA-N |
| XLogP | 5.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|