C22H24O5 — CID 102179316
phenyl-[3,5,7-trihydroxy-2-(4-methylpent-3-enyl)-3,4-dihydro-2H-chromen-8-yl]methanone (PubChem CID 102179316) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is phenyl-[3,5,7-trihydroxy-2-(4-methylpent-3-enyl)-3,4-dihydro-2H-chromen-8-yl]methanone.
| Compound Name | phenyl-[3,5,7-trihydroxy-2-(4-methylpent-3-enyl)-3,4-dihydro-2H-chromen-8-yl]methanone |
|---|---|
| PubChem CID | 102179316 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | phenyl-[3,5,7-trihydroxy-2-(4-methylpent-3-enyl)-3,4-dihydro-2H-chromen-8-yl]methanone |
| SMILES | CC(C)=CCCC1Oc2c(c(O)cc(O)c2C(=O)c2ccccc2)CC1O |
| InChI | InChI=1S/C22H24O5/c1-13(2)7-6-10-19-17(24)11-15-16(23)12-18(25)20(22(15)27-19)21(26)14-8-4-3-5-9-14/h3-5,7-9,12,17,19,23-25H,6,10-11H2,1-2H3 |
| InChIKey | WDKGWMQIQJKJNQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|