C25H28O3 — CID 162844838
(2S)-7-hydroxy-6,8-bis(3-methylbut-2-enyl)-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 162844838) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is (2S)-7-hydroxy-6,8-bis(3-methylbut-2-enyl)-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-7-hydroxy-6,8-bis(3-methylbut-2-enyl)-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 162844838 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (2S)-7-hydroxy-6,8-bis(3-methylbut-2-enyl)-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCc1cc2c(c(CC=C(C)C)c1O)O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C25H28O3/c1-16(2)10-12-19-14-21-22(26)15-23(18-8-6-5-7-9-18)28-25(21)20(24(19)27)13-11-17(3)4/h5-11,14,23,27H,12-13,15H2,1-4H3/t23-/m0/s1 |
| InChIKey | QRCTUFJCBXMBPP-QHCPKHFHSA-N |
| XLogP | 6.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|