C25H26O3 — CID 162875405
(8S)-2,2-dimethyl-10-(3-methylbut-2-enyl)-8-phenyl-7,8-dihydropyrano[3,2-g]chromen-6-one (PubChem CID 162875405) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is (8S)-2,2-dimethyl-10-(3-methylbut-2-enyl)-8-phenyl-7,8-dihydropyrano[3,2-g]chromen-6-one.
| Compound Name | (8S)-2,2-dimethyl-10-(3-methylbut-2-enyl)-8-phenyl-7,8-dihydropyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 162875405 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (8S)-2,2-dimethyl-10-(3-methylbut-2-enyl)-8-phenyl-7,8-dihydropyrano[3,2-g]chromen-6-one |
| SMILES | CC(C)=CCc1c2c(cc3c1O[C@H](c1ccccc1)CC3=O)C=CC(C)(C)O2 |
| InChI | InChI=1S/C25H26O3/c1-16(2)10-11-19-23-18(12-13-25(3,4)28-23)14-20-21(26)15-22(27-24(19)20)17-8-6-5-7-9-17/h5-10,12-14,22H,11,15H2,1-4H3/t22-/m0/s1 |
| InChIKey | VBTDTADYYPMGAF-QFIPXVFZSA-N |
| XLogP | 6.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|