C30H34O5 — CID 162919555
(2S)-2-(2,2-dimethylchromen-6-yl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 162919555) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is (2S)-2-(2,2-dimethylchromen-6-yl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-2-(2,2-dimethylchromen-6-yl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 162919555 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (2S)-2-(2,2-dimethylchromen-6-yl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)C(=O)C[C@@H](c1ccc3c(c1)C=CC(C)(C)O3)O2 |
| InChI | InChI=1S/C30H34O5/c1-17(2)7-10-21-27(32)22(11-8-18(3)4)29-26(28(21)33)23(31)16-25(34-29)19-9-12-24-20(15-19)13-14-30(5,6)35-24/h7-9,12-15,25,32-33H,10-11,16H2,1-6H3/t25-/m0/s1 |
| InChIKey | RPCILRXZRGPPAQ-VWLOTQADSA-N |
| XLogP | 7.01 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|