C30H34O6 — CID 163060313
(2R)-5,7-dihydroxy-2-(8-hydroxy-2,2-dimethylchromen-6-yl)-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 163060313) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is (2R)-5,7-dihydroxy-2-(8-hydroxy-2,2-dimethylchromen-6-yl)-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-5,7-dihydroxy-2-(8-hydroxy-2,2-dimethylchromen-6-yl)-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163060313 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (2R)-5,7-dihydroxy-2-(8-hydroxy-2,2-dimethylchromen-6-yl)-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)C(=O)C[C@H](c1cc(O)c3c(c1)C=CC(C)(C)O3)O2 |
| InChI | InChI=1S/C30H34O6/c1-16(2)7-9-20-26(33)21(10-8-17(3)4)29-25(27(20)34)22(31)15-24(35-29)19-13-18-11-12-30(5,6)36-28(18)23(32)14-19/h7-8,11-14,24,32-34H,9-10,15H2,1-6H3/t24-/m1/s1 |
| InChIKey | XESZEJDJGPNKIH-XMMPIXPASA-N |
| XLogP | 6.71 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|