C31H32O9 — CID 10076189
[3-acetyloxy-5-[(8S)-5-acetyloxy-2,2-dimethyl-10-(3-methylbut-2-enyl)-6-oxo-7,8-dihydropyrano[3,2-g]chromen-8-yl]phenyl] acetate (PubChem CID 10076189) has the molecular formula C31H32O9 and a molecular weight of 548.59 g/mol. Its IUPAC name is [3-acetyloxy-5-[(8S)-5-acetyloxy-2,2-dimethyl-10-(3-methylbut-2-enyl)-6-oxo-7,8-dihydropyrano[3,2-g]chromen-8-yl]phenyl] acetate.
| Compound Name | [3-acetyloxy-5-[(8S)-5-acetyloxy-2,2-dimethyl-10-(3-methylbut-2-enyl)-6-oxo-7,8-dihydropyrano[3,2-g]chromen-8-yl]phenyl] acetate |
|---|---|
| PubChem CID | 10076189 |
| Molecular Formula | C31H32O9 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | [3-acetyloxy-5-[(8S)-5-acetyloxy-2,2-dimethyl-10-(3-methylbut-2-enyl)-6-oxo-7,8-dihydropyrano[3,2-g]chromen-8-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc([C@@H]2CC(=O)c3c(OC(C)=O)c4c(c(CC=C(C)C)c3O2)OC(C)(C)C=C4)c1 |
| InChI | InChI=1S/C31H32O9/c1-16(2)8-9-23-28-24(10-11-31(6,7)40-28)29(38-19(5)34)27-25(35)15-26(39-30(23)27)20-12-21(36-17(3)32)14-22(13-20)37-18(4)33/h8,10-14,26H,9,15H2,1-7H3/t26-/m0/s1 |
| InChIKey | IOURYQSUWANSGI-SANMLTNESA-N |
| XLogP | 5.86 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|