C14H10O6 — CID 154360327
3-benzoyl-2,4,6-trihydroxybenzoic acid (PubChem CID 154360327) has the molecular formula C14H10O6 and a molecular weight of 274.23 g/mol. Its IUPAC name is 3-benzoyl-2,4,6-trihydroxybenzoic acid.
| Compound Name | 3-benzoyl-2,4,6-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 154360327 |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 3-benzoyl-2,4,6-trihydroxybenzoic acid |
| SMILES | O=C(O)c1c(O)cc(O)c(C(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C14H10O6/c15-8-6-9(16)11(14(19)20)13(18)10(8)12(17)7-4-2-1-3-5-7/h1-6,15-16,18H,(H,19,20) |
| InChIKey | DIZTZSRMQCOUQR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |