C27H18O9 — CID 70582995
diphenylmethanone;naphthalene-1,2,3,4-tetracarboxylic acid (PubChem CID 70582995) has the molecular formula C27H18O9 and a molecular weight of 486.43 g/mol. Its IUPAC name is diphenylmethanone;naphthalene-1,2,3,4-tetracarboxylic acid.
| Compound Name | diphenylmethanone;naphthalene-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 70582995 |
| Molecular Formula | C27H18O9 |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | diphenylmethanone;naphthalene-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)c1c(C(=O)O)c(C(=O)O)c2ccccc2c1C(=O)O.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H8O8.C13H10O/c15-11(16)7-5-3-1-2-4-6(5)8(12(17)18)10(14(21)22)9(7)13(19)20;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-4H,(H,15,16)(H,17,18)(H,19,20)(H,21,22);1-10H |
| InChIKey | AKBCVLAEWJOLFT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |