About anthracene;diphenylmethanone
anthracene;diphenylmethanone (PubChem CID 87408663) has the molecular formula C27H20O
and a molecular weight of 360.46 g/mol. Its IUPAC name is anthracene;diphenylmethanone.
Molecular Properties
| Compound Name | anthracene;diphenylmethanone |
| PubChem CID | 87408663 |
| Molecular Formula | C27H20O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | anthracene;diphenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C13H10O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2*1-10H |
| InChIKey | LJJNOQFKTSHUSN-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;diphenylmethanone?
The IUPAC name of anthracene;diphenylmethanone (CID 87408663) is anthracene;diphenylmethanone.
What is the SMILES notation for anthracene;diphenylmethanone?
The canonical SMILES for anthracene;diphenylmethanone is O=C(c1ccccc1)c1ccccc1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;diphenylmethanone?
The InChIKey is LJJNOQFKTSHUSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C13H10O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2*1-10H.
What are the key properties of anthracene;diphenylmethanone?
anthracene;diphenylmethanone has a molecular weight of 360.46 g/mol, XLogP of 6.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;diphenylmethanone is sourced from PubChem (CID 87408663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).