About anthracene;carbamic acid
anthracene;carbamic acid (PubChem CID 175829051) has the molecular formula C16H16N2O4
and a molecular weight of 300.31 g/mol. Its IUPAC name is anthracene;carbamic acid.
Molecular Properties
| Compound Name | anthracene;carbamic acid |
| PubChem CID | 175829051 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | anthracene;carbamic acid |
| SMILES | NC(=O)O.NC(=O)O.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.2CH3NO2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;2*2-1(3)4/h1-10H;2*2H2,(H,3,4) |
| InChIKey | OUQLRDFFGFKDLG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;carbamic acid?
The IUPAC name of anthracene;carbamic acid (CID 175829051) is anthracene;carbamic acid.
What is the SMILES notation for anthracene;carbamic acid?
The canonical SMILES for anthracene;carbamic acid is NC(=O)O.NC(=O)O.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;carbamic acid?
The InChIKey is OUQLRDFFGFKDLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.2CH3NO2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;2*2-1(3)4/h1-10H;2*2H2,(H,3,4).
What are the key properties of anthracene;carbamic acid?
anthracene;carbamic acid has a molecular weight of 300.31 g/mol, XLogP of 3.24, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;carbamic acid is sourced from PubChem (CID 175829051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).