About carbamic acid;naphthalene
carbamic acid;naphthalene (PubChem CID 162082147) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is carbamic acid;naphthalene.
Molecular Properties
| Compound Name | carbamic acid;naphthalene |
| PubChem CID | 162082147 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | carbamic acid;naphthalene |
| SMILES | NC(=O)O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.CH3NO2/c1-2-6-10-8-4-3-7-9(10)5-1;2-1(3)4/h1-8H;2H2,(H,3,4) |
| InChIKey | ZCMFDYPLQCWJEQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze carbamic acid;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;naphthalene?
The IUPAC name of carbamic acid;naphthalene (CID 162082147) is carbamic acid;naphthalene.
What is the SMILES notation for carbamic acid;naphthalene?
The canonical SMILES for carbamic acid;naphthalene is NC(=O)O.c1ccc2ccccc2c1.
What is the InChIKey of carbamic acid;naphthalene?
The InChIKey is ZCMFDYPLQCWJEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.CH3NO2/c1-2-6-10-8-4-3-7-9(10)5-1;2-1(3)4/h1-8H;2H2,(H,3,4).
What are the key properties of carbamic acid;naphthalene?
carbamic acid;naphthalene has a molecular weight of 189.21 g/mol, XLogP of 2.46, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;naphthalene is sourced from PubChem (CID 162082147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).