About methane;naphthalene;propan-2-one
methane;naphthalene;propan-2-one (PubChem CID 159038766) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is methane;naphthalene;propan-2-one.
Molecular Properties
| Compound Name | methane;naphthalene;propan-2-one |
| PubChem CID | 159038766 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | methane;naphthalene;propan-2-one |
| SMILES | C.CC(C)=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C3H6O.CH4/c1-2-6-10-8-4-3-7-9(10)5-1;1-3(2)4;/h1-8H;1-2H3;1H4 |
| InChIKey | JVTYIQXAWHUWRL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;naphthalene;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;naphthalene;propan-2-one?
The IUPAC name of methane;naphthalene;propan-2-one (CID 159038766) is methane;naphthalene;propan-2-one.
What is the SMILES notation for methane;naphthalene;propan-2-one?
The canonical SMILES for methane;naphthalene;propan-2-one is C.CC(C)=O.c1ccc2ccccc2c1.
What is the InChIKey of methane;naphthalene;propan-2-one?
The InChIKey is JVTYIQXAWHUWRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C3H6O.CH4/c1-2-6-10-8-4-3-7-9(10)5-1;1-3(2)4;/h1-8H;1-2H3;1H4.
What are the key properties of methane;naphthalene;propan-2-one?
methane;naphthalene;propan-2-one has a molecular weight of 202.30 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;naphthalene;propan-2-one is sourced from PubChem (CID 159038766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).