About biphenylene;propan-2-one
biphenylene;propan-2-one (PubChem CID 174440223) has the molecular formula C15H14O
and a molecular weight of 210.28 g/mol. Its IUPAC name is biphenylene;propan-2-one.
Molecular Properties
| Compound Name | biphenylene;propan-2-one |
| PubChem CID | 174440223 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | biphenylene;propan-2-one |
| SMILES | CC(C)=O.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.C3H6O/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-3(2)4/h1-8H;1-2H3 |
| InChIKey | IDJNANUVISHEGM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze biphenylene;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;propan-2-one?
The IUPAC name of biphenylene;propan-2-one (CID 174440223) is biphenylene;propan-2-one.
What is the SMILES notation for biphenylene;propan-2-one?
The canonical SMILES for biphenylene;propan-2-one is CC(C)=O.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;propan-2-one?
The InChIKey is IDJNANUVISHEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.C3H6O/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-3(2)4/h1-8H;1-2H3.
What are the key properties of biphenylene;propan-2-one?
biphenylene;propan-2-one has a molecular weight of 210.28 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;propan-2-one is sourced from PubChem (CID 174440223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).