acetic acid;biphenylen-2-ol

C14H12O3 — CID 71351696

IUPACacetic acid;biphenylen-2-ol
SMILESCC(=O)O.Oc1ccc2c(c1)-c1ccccc1-2
InChIInChI=1S/C12H8O.C2H4O2/c13-8-5-6-11-9-3-1-2-4-10(9)12(11)7-8;1-2(3)4/h1-7,13H;1H3,(H,3,4)
InChIKeyICHCWEHYFCERLC-UHFFFAOYSA-N
MW228.25 g/mol
LogP3.13
Rot. Bonds

About acetic acid;biphenylen-2-ol

acetic acid;biphenylen-2-ol (PubChem CID 71351696) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is acetic acid;biphenylen-2-ol.

Molecular Properties

Compound Nameacetic acid;biphenylen-2-ol
PubChem CID71351696
Molecular FormulaC14H12O3
Molecular Weight228.25 g/mol
Exact Mass228.08
IUPAC Nameacetic acid;biphenylen-2-ol
SMILESCC(=O)O.Oc1ccc2c(c1)-c1ccccc1-2
InChIInChI=1S/C12H8O.C2H4O2/c13-8-5-6-11-9-3-1-2-4-10(9)12(11)7-8;1-2(3)4/h1-7,13H;1H3,(H,3,4)
InChIKeyICHCWEHYFCERLC-UHFFFAOYSA-N
XLogP3.13
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.25
LogP ≤ 53.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze acetic acid;biphenylen-2-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;biphenylen-2-ol?
The IUPAC name of acetic acid;biphenylen-2-ol (CID 71351696) is acetic acid;biphenylen-2-ol.
What is the SMILES notation for acetic acid;biphenylen-2-ol?
The canonical SMILES for acetic acid;biphenylen-2-ol is CC(=O)O.Oc1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of acetic acid;biphenylen-2-ol?
The InChIKey is ICHCWEHYFCERLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O.C2H4O2/c13-8-5-6-11-9-3-1-2-4-10(9)12(11)7-8;1-2(3)4/h1-7,13H;1H3,(H,3,4).
What are the key properties of acetic acid;biphenylen-2-ol?
acetic acid;biphenylen-2-ol has a molecular weight of 228.25 g/mol, XLogP of 3.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;biphenylen-2-ol is sourced from PubChem (CID 71351696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).