C18H16OS — CID 172728711
3,4-diphenylphenol;sulfane (PubChem CID 172728711) has the molecular formula C18H16OS and a molecular weight of 280.39 g/mol. Its IUPAC name is 3,4-diphenylphenol;sulfane.
| Compound Name | 3,4-diphenylphenol;sulfane |
|---|---|
| PubChem CID | 172728711 |
| Molecular Formula | C18H16OS |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3,4-diphenylphenol;sulfane |
| SMILES | Oc1ccc(-c2ccccc2)c(-c2ccccc2)c1.S |
| InChI | InChI=1S/C18H14O.H2S/c19-16-11-12-17(14-7-3-1-4-8-14)18(13-16)15-9-5-2-6-10-15;/h1-13,19H;1H2 |
| InChIKey | HMQKVYIAXRFQEG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |