About 4-phenyl-3-silylphenol
4-phenyl-3-silylphenol (PubChem CID 137329798) has the molecular formula C12H12OSi
and a molecular weight of 200.31 g/mol. Its IUPAC name is 4-phenyl-3-silylphenol.
Molecular Properties
| Compound Name | 4-phenyl-3-silylphenol |
| PubChem CID | 137329798 |
| Molecular Formula | C12H12OSi |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-phenyl-3-silylphenol |
| SMILES | Oc1ccc(-c2ccccc2)c([SiH3])c1 |
| InChI | InChI=1S/C12H12OSi/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h1-8,13H,14H3 |
| InChIKey | FXJPAQJNCIWLRC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyl-3-silylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-3-silylphenol?
The IUPAC name of 4-phenyl-3-silylphenol (CID 137329798) is 4-phenyl-3-silylphenol.
What is the SMILES notation for 4-phenyl-3-silylphenol?
The canonical SMILES for 4-phenyl-3-silylphenol is Oc1ccc(-c2ccccc2)c([SiH3])c1.
What is the InChIKey of 4-phenyl-3-silylphenol?
The InChIKey is FXJPAQJNCIWLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12OSi/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h1-8,13H,14H3.
What are the key properties of 4-phenyl-3-silylphenol?
4-phenyl-3-silylphenol has a molecular weight of 200.31 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-3-silylphenol is sourced from PubChem (CID 137329798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).