C24H20O4 — CID 69274449
2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol (PubChem CID 69274449) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol.
| Compound Name | 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol |
|---|---|
| PubChem CID | 69274449 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol |
| SMILES | Oc1ccc(-c2ccccc2)c(O)c1.Oc1ccccc1-c1ccccc1O |
| InChI | InChI=1S/2C12H10O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14;13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h2*1-8,13-14H |
| InChIKey | UOKKHROISXBIKL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |