About 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol
2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol (PubChem CID 69274449) has the molecular formula C24H20O4
and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol.
Molecular Properties
| Compound Name | 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol |
| PubChem CID | 69274449 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol |
| SMILES | Oc1ccc(-c2ccccc2)c(O)c1.Oc1ccccc1-c1ccccc1O |
| InChI | InChI=1S/2C12H10O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14;13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h2*1-8,13-14H |
| InChIKey | UOKKHROISXBIKL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol?
The IUPAC name of 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol (CID 69274449) is 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol.
What is the SMILES notation for 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol?
The canonical SMILES for 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol is Oc1ccc(-c2ccccc2)c(O)c1.Oc1ccccc1-c1ccccc1O.
What is the InChIKey of 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol?
The InChIKey is UOKKHROISXBIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14;13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h2*1-8,13-14H.
What are the key properties of 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol?
2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol has a molecular weight of 372.42 g/mol, XLogP of 5.53, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyphenyl)phenol;4-phenylbenzene-1,3-diol is sourced from PubChem (CID 69274449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).