C26H26O2 — CID 90025475
1,1'-biphenyl;ethanol;2-phenylphenol (PubChem CID 90025475) has the molecular formula C26H26O2 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1,1'-biphenyl;ethanol;2-phenylphenol.
| Compound Name | 1,1'-biphenyl;ethanol;2-phenylphenol |
|---|---|
| PubChem CID | 90025475 |
| Molecular Formula | C26H26O2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1,1'-biphenyl;ethanol;2-phenylphenol |
| SMILES | CCO.Oc1ccccc1-c1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C12H10.C2H6O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3/h1-9,13H;1-10H;3H,2H2,1H3 |
| InChIKey | NZEWYBCDMNKFIJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |