About methyl hydrogen carbonate;2-phenylphenol
methyl hydrogen carbonate;2-phenylphenol (PubChem CID 67829227) has the molecular formula C14H14O4
and a molecular weight of 246.26 g/mol. Its IUPAC name is methyl hydrogen carbonate;2-phenylphenol.
Molecular Properties
| Compound Name | methyl hydrogen carbonate;2-phenylphenol |
| PubChem CID | 67829227 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | methyl hydrogen carbonate;2-phenylphenol |
| SMILES | COC(=O)O.Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O.C2H4O3/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5-2(3)4/h1-9,13H;1H3,(H,3,4) |
| InChIKey | OFUDCOJZOKNPNU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl hydrogen carbonate;2-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl hydrogen carbonate;2-phenylphenol?
The IUPAC name of methyl hydrogen carbonate;2-phenylphenol (CID 67829227) is methyl hydrogen carbonate;2-phenylphenol.
What is the SMILES notation for methyl hydrogen carbonate;2-phenylphenol?
The canonical SMILES for methyl hydrogen carbonate;2-phenylphenol is COC(=O)O.Oc1ccccc1-c1ccccc1.
What is the InChIKey of methyl hydrogen carbonate;2-phenylphenol?
The InChIKey is OFUDCOJZOKNPNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C2H4O3/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5-2(3)4/h1-9,13H;1H3,(H,3,4).
What are the key properties of methyl hydrogen carbonate;2-phenylphenol?
methyl hydrogen carbonate;2-phenylphenol has a molecular weight of 246.26 g/mol, XLogP of 3.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hydrogen carbonate;2-phenylphenol is sourced from PubChem (CID 67829227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).