About 5-methoxy-2-phenylphenol;propan-2-one
5-methoxy-2-phenylphenol;propan-2-one (PubChem CID 175099013) has the molecular formula C16H18O3
and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-methoxy-2-phenylphenol;propan-2-one.
Molecular Properties
| Compound Name | 5-methoxy-2-phenylphenol;propan-2-one |
| PubChem CID | 175099013 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 5-methoxy-2-phenylphenol;propan-2-one |
| SMILES | CC(C)=O.COc1ccc(-c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C13H12O2.C3H6O/c1-15-11-7-8-12(13(14)9-11)10-5-3-2-4-6-10;1-3(2)4/h2-9,14H,1H3;1-2H3 |
| InChIKey | LSWIOBIRGDTZFD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-2-phenylphenol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-phenylphenol;propan-2-one?
The IUPAC name of 5-methoxy-2-phenylphenol;propan-2-one (CID 175099013) is 5-methoxy-2-phenylphenol;propan-2-one.
What is the SMILES notation for 5-methoxy-2-phenylphenol;propan-2-one?
The canonical SMILES for 5-methoxy-2-phenylphenol;propan-2-one is CC(C)=O.COc1ccc(-c2ccccc2)c(O)c1.
What is the InChIKey of 5-methoxy-2-phenylphenol;propan-2-one?
The InChIKey is LSWIOBIRGDTZFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2.C3H6O/c1-15-11-7-8-12(13(14)9-11)10-5-3-2-4-6-10;1-3(2)4/h2-9,14H,1H3;1-2H3.
What are the key properties of 5-methoxy-2-phenylphenol;propan-2-one?
5-methoxy-2-phenylphenol;propan-2-one has a molecular weight of 258.32 g/mol, XLogP of 3.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-phenylphenol;propan-2-one is sourced from PubChem (CID 175099013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).