About 5-butoxy-2-phenylphenol
5-butoxy-2-phenylphenol (PubChem CID 70451587) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 5-butoxy-2-phenylphenol.
Molecular Properties
| Compound Name | 5-butoxy-2-phenylphenol |
| PubChem CID | 70451587 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 5-butoxy-2-phenylphenol |
| SMILES | CCCCOc1ccc(-c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C16H18O2/c1-2-3-11-18-14-9-10-15(16(17)12-14)13-7-5-4-6-8-13/h4-10,12,17H,2-3,11H2,1H3 |
| InChIKey | ZAEQPFPNKWOTMD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-2-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-2-phenylphenol?
The IUPAC name of 5-butoxy-2-phenylphenol (CID 70451587) is 5-butoxy-2-phenylphenol.
What is the SMILES notation for 5-butoxy-2-phenylphenol?
The canonical SMILES for 5-butoxy-2-phenylphenol is CCCCOc1ccc(-c2ccccc2)c(O)c1.
What is the InChIKey of 5-butoxy-2-phenylphenol?
The InChIKey is ZAEQPFPNKWOTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2/c1-2-3-11-18-14-9-10-15(16(17)12-14)13-7-5-4-6-8-13/h4-10,12,17H,2-3,11H2,1H3.
What are the key properties of 5-butoxy-2-phenylphenol?
5-butoxy-2-phenylphenol has a molecular weight of 242.32 g/mol, XLogP of 4.24, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-2-phenylphenol is sourced from PubChem (CID 70451587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).