C41H39N3O4 — CID 135621952
2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol (PubChem CID 135621952) has the molecular formula C41H39N3O4 and a molecular weight of 637.78 g/mol. Its IUPAC name is 2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol.
| Compound Name | 2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol |
|---|---|
| PubChem CID | 135621952 |
| Molecular Formula | C41H39N3O4 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | 2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol |
| SMILES | CCCCCCCCOc1ccc(-c2nc(-c3ccc(Oc4ccccc4)cc3)nc(-c3ccc(Oc4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C41H39N3O4/c1-2-3-4-5-6-13-28-46-36-26-27-37(38(45)29-36)41-43-39(30-18-22-34(23-19-30)47-32-14-9-7-10-15-32)42-40(44-41)31-20-24-35(25-21-31)48-33-16-11-8-12-17-33/h7-12,14-27,29,45H,2-6,13,28H2,1H3 |
| InChIKey | JWZPAYKLAMXRAF-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|