C34H25N3O3 — CID 135621950
2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-methylphenol (PubChem CID 135621950) has the molecular formula C34H25N3O3 and a molecular weight of 523.59 g/mol. Its IUPAC name is 2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-methylphenol.
| Compound Name | 2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-methylphenol |
|---|---|
| PubChem CID | 135621950 |
| Molecular Formula | C34H25N3O3 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-methylphenol |
| SMILES | Cc1ccc(-c2nc(-c3ccc(Oc4ccccc4)cc3)nc(-c3ccc(Oc4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C34H25N3O3/c1-23-12-21-30(31(38)22-23)34-36-32(24-13-17-28(18-14-24)39-26-8-4-2-5-9-26)35-33(37-34)25-15-19-29(20-16-25)40-27-10-6-3-7-11-27/h2-22,38H,1H3 |
| InChIKey | SPGMIOMWFHZBKH-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |