C25H23N3O — CID 135671150
2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]phenol (PubChem CID 135671150) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]phenol.
| Compound Name | 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]phenol |
|---|---|
| PubChem CID | 135671150 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]phenol |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccccc3O)n2)c(C)c1 |
| InChI | InChI=1S/C25H23N3O/c1-15-9-11-19(17(3)13-15)23-26-24(20-12-10-16(2)14-18(20)4)28-25(27-23)21-7-5-6-8-22(21)29/h5-14,29H,1-4H3 |
| InChIKey | LSURWFZZCCABSQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |